Alcohols, C13-15-branched and linear, butoxylated ethoxylated (Cat.No:R022199) are a group of versatile non-ionic surfactants. They find extensive use in various industries such as detergents, textiles, and agriculture. These compounds are effective emulsifiers and wetting agents, enhancing the stability and performance of formulations while reducing surface tension.
Catalog Number | R022199 |
CAS Number | 108-05-4 |
Synonyms | Acetic Acid Vinyl Ester; 1-Acetoxyethylene; Acetic Acid Ethenyl Ester; Acetoxyethene; Acetoxyethylene; Ethenyl Acetate; NSC 8404; SN 12T; Vinyl A Monomer; Vinyl Acetate |
Molecular Formula | C4H6O2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | ethenyl acetate |
InChI | InChI=1S/C4H6O2/c1-3-6-4(2)5/h3H,1H2,2H3 |
InChIKey | XTXRWKRVRITETP-UHFFFAOYSA-N |
SMILES | CC(=O)OC=C |
Reference | <span style=”color:#000000;”><span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Tan, Bien, Jun-Young Lee, and Andrew I. Cooper. "Synthesis of emulsion-templated poly (acrylamide) using CO2-in-water emulsions and poly (vinyl acetate)-based block copolymer surfactants." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Macromolecules</i></span></span></span><span style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”><span style=”color:#000000;”><span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”> 40.6 (2007): 1945-1954.</span></span></span></span><br /> |