For research use only. Not for therapeutic Use.
Vinclozolin (Cat.No:R050760) is a widely used fungicide in agriculture, particularly for protecting crops like grapes, tomatoes, and strawberries. It inhibits fungal spore germination and mycelial growth. However, its endocrine-disrupting properties have led to concerns over its environmental impact and its regulation in certain regions.
CAS Number | 50471-44-8 |
Synonyms | 3-(3,5-Dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione; (+/-)-Vinclozolin; BAS 352-04F; BAS 35202F; BAS 35204; N-3,5-Dichlorophenyl-5-methyl-5-?vinyloxazolidine-2,4-dione; Ornalin; Ranilan; Ronilan; Ronilan 50WP; |
Molecular Formula | C12H9Cl2NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-1,3-oxazolidine-2,4-dione |
InChI | InChI=1S/C12H9Cl2NO3/c1-3-12(2)10(16)15(11(17)18-12)9-5-7(13)4-8(14)6-9/h3-6H,1H2,2H3 |
InChIKey | FSCWZHGZWWDELK-UHFFFAOYSA-N |
SMILES | CC1(C(=O)N(C(=O)O1)C2=CC(=CC(=C2)Cl)Cl)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |