For research use only. Not for therapeutic Use.
Viaminate(CAT: I040707) is a synthetic retinoic acid derivative and a vitamin A analog known for its hepatoprotective and anti-inflammatory properties. It has been studied for its potential in treating liver disorders, including chronic hepatitis and liver fibrosis. Viaminate works by modulating gene expression through retinoic acid receptors (RARs), influencing cell differentiation, immune response, and fibrotic processes. Its regulatory effect on hepatic stellate cells contributes to reduced collagen production and fibrosis progression. Due to its bioactivity and therapeutic relevance, Viaminate is a valuable compound in liver disease research and the development of novel treatments for hepatic and inflammatory conditions.
| CAS Number | 53839-71-7 |
| Synonyms | ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate |
| Molecular Formula | C29H37NO3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate |
| InChI | InChI=1S/C29H37NO3/c1-7-33-28(32)24-14-16-25(17-15-24)30-27(31)20-22(3)11-8-10-21(2)13-18-26-23(4)12-9-19-29(26,5)6/h8,10-11,13-18,20H,7,9,12,19H2,1-6H3,(H,30,31)/b11-8+,18-13+,21-10+,22-20+ |
| InChIKey | VRSMJNVXOITYPE-FSDIUQKZSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)C=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
