For research use only. Not for therapeutic Use.
Verrucosin（Cat No.:I043643）is a naturally occurring compound with significant biological activity, primarily known for its anti-inflammatory and antimicrobial properties. It is derived from fungal species and has shown potential in inhibiting various bacterial and fungal infections. Additionally, verrucosin has demonstrated anticancer properties in some preclinical studies, exhibiting the ability to suppress tumor cell growth. Its diverse biological effects make it a subject of interest for developing novel therapeutic agents, especially in the fields of infectious disease, inflammation, and oncology. Ongoing research is focused on exploring its full therapeutic potential and mechanisms of action.
| CAS Number | 83198-63-4 |
| Synonyms | 4-[(2S,3S,4S,5R)-5-(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Molecular Formula | C20H24O5 |
| Purity | ≥95% |
| IUPAC Name | 4-[(3S,4S)-5-(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| InChI | InChI=1S/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3/t11-,12-,19?,20?/m0/s1 |
| InChIKey | GMXMKSFJQLFOSO-FPXVXZFJSA-N |
| SMILES | C[C@H]1[C@@H](C(OC1C2=CC(=C(C=C2)O)OC)C3=CC(=C(C=C3)O)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
