For research use only. Not for therapeutic Use.
Vanillyl alcohol(CAT: R072369) is an organic compound belonging to the family of phenolic alcohols. Its mode of action involves being a natural compound found in certain plant sources, including vanilla beans. Vanillyl alcohol has a pleasant, sweet, and vanilla-like aroma, which makes it valuable as a flavoring and fragrance ingredient in the food and cosmetic industries. It is also used in the synthesis of various chemicals and pharmaceutical compounds. Additionally, Vanillyl alcohol exhibits antioxidant properties and has been studied for its potential health benefits.
| CAS Number | 498-00-0 |
| Molecular Formula | C8H10O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | 4-(hydroxymethyl)-2-methoxyphenol |
| InChI | InChI=1S/C8H10O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,9-10H,5H2,1H3 |
| InChIKey | ZENOXNGFMSCLLL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |