For research use only. Not for therapeutic Use.
Valganciclovir(Cat No.:I002292)is an antiviral medication used to treat infections caused by cytomegalovirus (CMV), particularly in immunocompromised patients, such as those undergoing organ transplantation or with HIV/AIDS. It works by inhibiting CMV replication through the inhibition of viral DNA synthesis. Valganciclovir is the oral prodrug of ganciclovir, offering improved bioavailability. It is primarily used to prevent and treat CMV retinitis and CMV disease in transplant recipients. While effective, it requires careful monitoring for potential side effects, including neutropenia, thrombocytopenia, and renal toxicity.
| CAS Number | 175865-60-8 |
| Synonyms | Cymeval; Valganciclovir [INN:BAN]; L-Valine, ester with ganciclovir |
| Molecular Formula | C14H22N6O5 |
| Purity | ≥95% |
| Target | CMV |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] (2S)-2-amino-3-methylbutanoate |
| InChI | InChI=1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1 |
| InChIKey | WPVFJKSGQUFQAP-GKAPJAKFSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N)N |
| Reference | <p style=”/line-height:25px/”> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |