(-)-Valerenic Acid is a high-purity compound essential for advanced pharmaceutical and biochemical research. This sesquiterpenoid acid is crucial for studies on GABA receptor modulation, herbal medicine, and neuropharmacology. Known for its stability and bioactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| Catalog Number | R021861 |
| CAS Number | 3569-10-6 |
| Synonyms | (2E)-3-[(4S,7R,7aR)-2,4,5,6,7,7a-Hexahydro-3,7-dimethyl-1H-inden-4-yl]-2-methyl-2-?propenoic Acid; [4S-[4α(E),7β,7aα]]-3-(2,4,5,6,7,7a-Hexahydro-3,7-dimethyl-1H-inden-4-yl)-2-methyl-2-propenoic Acid; 2,4,5,6,7,7a-Hexahydro-α,3,7-trimethylindene-4-acr |
| Molecular Formula | C15H22O2 |
| Purity | 95% |
| Target | GABA Receptor |
| Solubility | Soluble in ethanol |
| Storage | Store at +4C |
| IUPAC Name | (E)-3-[(4S,7R,7aR)-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-2-methylprop-2-enoic acid |
| InChI | InChI=1S/C15H22O2/c1-9-4-6-12(8-11(3)15(16)17)14-10(2)5-7-13(9)14/h8-9,12-13H,4-7H2,1-3H3,(H,16,17)/b11-8+/t9-,12+,13-/m1/s1 |
| InChIKey | FEBNTWHYQKGEIQ-SUKRRCERSA-N |
| SMILES | CC1CCC(C2=C(CCC12)C)C=C(C)C(=O)O |
