For research use only. Not for therapeutic Use.
Val-Cit-PAB-OSBT(CAT: I040448) is a cleavable linker used in the synthesis of antibody-drug conjugates (ADCs), engineered to enable selective drug release within target cells. It consists of the dipeptide Valine-Citrulline (Val-Cit), a self-immolative para-aminobenzyl (PAB) spacer, and a reactive OSBT (ortho-succinimidyl benzoyl thioester) group that facilitates stable conjugation to payloads or antibodies. Upon internalization into lysosomes, the Val-Cit linker is enzymatically cleaved by cathepsin B, triggering PAB-mediated release of the cytotoxic drug. This modular structure supports efficient and controlled drug delivery, making Val-Cit-PAB-OSBT a key component in the development of targeted, tumor-selective therapeutic ADCs with enhanced safety profiles.
| CAS Number | 2210262-26-1 |
| Synonyms | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-(carbamoylamino)pentanamide |
| Molecular Formula | C24H43N5O4Si |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-(carbamoylamino)pentanamide |
| InChI | InChI=1S/C24H43N5O4Si/c1-16(2)20(25)22(31)29-19(9-8-14-27-23(26)32)21(30)28-18-12-10-17(11-13-18)15-33-34(6,7)24(3,4)5/h10-13,16,19-20H,8-9,14-15,25H2,1-7H3,(H,28,30)(H,29,31)(H3,26,27,32)/t19-,20-/m0/s1 |
| InChIKey | GFLUZYWIOXHYRH-PMACEKPBSA-N |
| SMILES | CC(C)C(C(=O)NC(CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO[Si](C)(C)C(C)(C)C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
