For research use only. Not for therapeutic Use.
V-9302 hydrochloride(CAT: L004733) bearing a unique identifier, plays a pivotal role in pharmaceutical and organic chemistry. Its specific structure suggests its potential as a modulator of specific cellular pathways or targets. In pharmaceutical research, it may be investigated for its effects on disease-related processes, potentially impacting therapeutic development. The hydrochloride salt form ensures solubility and stability, crucial for formulation.
CAS Number | 2416138-42-4 |
Molecular Formula | C34H39ClN2O4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-4-[bis[[2-[(3-methylphenyl)methoxy]phenyl]methyl]amino]butanoic acid;hydrochloride |
InChI | InChI=1S/C34H38N2O4.ClH/c1-25-9-7-11-27(19-25)23-39-32-15-5-3-13-29(32)21-36(18-17-31(35)34(37)38)22-30-14-4-6-16-33(30)40-24-28-12-8-10-26(2)20-28;/h3-16,19-20,31H,17-18,21-24,35H2,1-2H3,(H,37,38);1H/t31-;/m0./s1 |
InChIKey | LUQMUDMPRZSZTJ-YNMZEGNTSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |