For research use only. Not for therapeutic Use.
UZH1（Cat No.:I044555）is a pioneering small-molecule inhibitor of ALKBH5, an m6A RNA demethylase that plays a critical role in RNA metabolism, gene expression, and stem cell differentiation. It exists as two enantiomers, UZH1a and UZH1b, with UZH1a being the active form that selectively inhibits ALKBH5, thereby increasing N6-methyladenosine (m6A) marks on RNA. This modulation impacts RNA stability, splicing, and translation, offering insights into epitranscriptomic regulation. UZH1 serves as a valuable chemical tool for investigating ALKBH5 functions in cancer biology and developmental processes, enabling potential therapeutic targeting of RNA demethylation pathways.
| CAS Number | 2925713-02-4 |
| Synonyms | N-[[1-[6-(benzylamino)pyrimidin-4-yl]-3-hydroxypiperidin-3-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]-2-hydroxybenzamide |
| Molecular Formula | C32H42N6O3 |
| Purity | ≥95% |
| IUPAC Name | N-[[1-[6-(benzylamino)pyrimidin-4-yl]-3-hydroxypiperidin-3-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]-2-hydroxybenzamide |
| InChI | InChI=1S/C32H42N6O3/c1-31(2)12-15-37(16-13-31)20-25-9-10-26(27(39)17-25)30(40)34-21-32(41)11-6-14-38(22-32)29-18-28(35-23-36-29)33-19-24-7-4-3-5-8-24/h3-5,7-10,17-18,23,39,41H,6,11-16,19-22H2,1-2H3,(H,34,40)(H,33,35,36) |
| InChIKey | PWYRDVXYAOGDNK-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)CC2=CC(=C(C=C2)C(=O)NCC3(CCCN(C3)C4=NC=NC(=C4)NCC5=CC=CC=C5)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
