For research use only. Not for therapeutic Use.
UT-11(Cat No.:I041374)is a small molecule compound under investigation for its potential therapeutic applications, particularly in the context of cancer and inflammation. It is studied for its ability to modulate specific biological pathways involved in tumor progression, immune responses, and cell survival. Research into UT-11 focuses on understanding its mechanism of action, safety, and efficacy in preclinical models. It holds promise as a potential treatment for various cancers, with ongoing studies examining its pharmacokinetics and potential to be used in combination therapies to enhance its effectiveness in targeting cancer cells and reducing inflammation.
Synonyms | 1-(5,6-dichloro-1,3-benzothiazol-2-yl)-N-[(3R)-oxolan-3-yl]piperidine-4-carboxamide |
Molecular Formula | C17H19Cl2N3O2S |
Purity | ≥95% |
IUPAC Name | 1-(5,6-dichloro-1,3-benzothiazol-2-yl)-N-[(3R)-oxolan-3-yl]piperidine-4-carboxamide |
InChI | InChI=1S/C17H19Cl2N3O2S/c18-12-7-14-15(8-13(12)19)25-17(21-14)22-4-1-10(2-5-22)16(23)20-11-3-6-24-9-11/h7-8,10-11H,1-6,9H2,(H,20,23)/t11-/m1/s1 |
InChIKey | CAIZZJVFQARMJL-LLVKDONJSA-N |
SMILES | C1COC[C@@H]1NC(=O)C2CCN(CC2)C3=NC4=CC(=C(C=C4S3)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |