For research use only. Not for therapeutic Use.
AZ1（Cat No.:I018162）is a potent small-molecule inhibitor of the deubiquitinases USP25 and USP28, enzymes that regulate protein stability and signaling through the ubiquitin–proteasome system. By blocking USP25/28 activity, AZ1 promotes degradation of oncogenic proteins such as c-Myc, impairing tumor cell proliferation and survival. Preclinical studies demonstrate its potential in cancer research, particularly in targeting pathways associated with tumor progression and resistance. AZ1 provides researchers with a valuable tool to investigate ubiquitin signaling, protein homeostasis, and the therapeutic potential of deubiquitinase inhibition in oncology and molecular biology.
| CAS Number | 2165322-94-9 |
| Synonyms | 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| Molecular Formula | C17H16BrF4NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| InChI | InChI=1S/C17H16BrF4NO2/c18-13-2-4-16(12(8-13)9-23-5-6-24)25-10-11-1-3-15(19)14(7-11)17(20,21)22/h1-4,7-8,23-24H,5-6,9-10H2 |
| InChIKey | ITHSFXDGKQYOED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1COC2=C(C=C(C=C2)Br)CNCCO)C(F)(F)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
