For research use only. Not for therapeutic Use.
Uralenol（Cat No.:M118879）is a triterpenoid compound isolated from plants in the Glycyrrhiza genus, particularly Glycyrrhiza uralensis (Chinese licorice), widely used in traditional Chinese medicine. Structurally related to oleanane-type triterpenes, uralenol exhibits several pharmacological activities, including anti-inflammatory, antioxidant, and hepatoprotective effects. It is known to modulate signaling pathways associated with inflammation and cellular stress, contributing to its potential therapeutic benefits. Uralenol also supports liver function and may aid in managing metabolic disorders. Its diverse bioactivity and natural origin make it a promising candidate for further research in herbal medicine and drug discovery.
| CAS Number | 139163-15-8 |
| Synonyms | 2-[3,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-3,5,7-trihydroxychromen-4-one |
| Molecular Formula | C20H18O7 |
| Purity | ≥95% |
| IUPAC Name | 2-[3,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-3,5,7-trihydroxychromen-4-one |
| InChI | InChI=1S/C20H18O7/c1-9(2)3-4-10-5-11(6-14(23)17(10)24)20-19(26)18(25)16-13(22)7-12(21)8-15(16)27-20/h3,5-8,21-24,26H,4H2,1-2H3 |
| InChIKey | WOMWVGHYSNATOB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
