For research use only. Not for therapeutic Use.
UNC9994 hydrochloride（Cat No.:I043482）is a selective small-molecule inhibitor of the lysine-specific demethylase 1 (LSD1), an enzyme involved in the regulation of gene expression through histone modification. By inhibiting LSD1, UNC9994 hydrochloride affects epigenetic regulation, influencing processes like cell differentiation, proliferation, and survival. It has shown potential in preclinical studies for the treatment of various cancers, particularly in leukemia and solid tumors, by disrupting tumor-promoting gene expression. Additionally, its ability to modify the epigenetic landscape positions it as a promising candidate in cancer therapy and other diseases associated with aberrant epigenetic regulation.
| CAS Number | 2108826-33-9 |
| Synonyms | 5-[3-[4-(2,3-dichlorophenyl)piperidin-1-yl]propoxy]-1,3-benzothiazole;hydrochloride |
| Molecular Formula | C21H23Cl3N2OS |
| Purity | ≥95% |
| IUPAC Name | 5-[3-[4-(2,3-dichlorophenyl)piperidin-1-yl]propoxy]-1,3-benzothiazole;hydrochloride |
| InChI | InChI=1S/C21H22Cl2N2OS.ClH/c22-18-4-1-3-17(21(18)23)15-7-10-25(11-8-15)9-2-12-26-16-5-6-20-19(13-16)24-14-27-20;/h1,3-6,13-15H,2,7-12H2;1H |
| InChIKey | MTDQOQYYKZUEEK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=C(C(=CC=C2)Cl)Cl)CCCOC3=CC4=C(C=C3)SC=N4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
