UNC1215(Cat No.:I001593)is a selective inhibitor of the histone demethylase JMJD2A, which is involved in the regulation of gene expression through the demethylation of tri-methylated lysine residues on histones. By inhibiting JMJD2A, UNC1215 alters the epigenetic landscape, leading to changes in chromatin structure and potential reactivation of silenced tumor suppressor genes. This compound has shown promise in preclinical studies for its anti-cancer effects, particularly in tumors where JMJD2A is overexpressed. UNC1215’s unique mechanism positions it as a valuable tool for investigating the role of histone demethylation in cancer and developing targeted therapies.
Catalog Number | I001593 |
CAS Number | 1415800-43-9 |
Synonyms | [3-anilino-4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
Molecular Formula | C32H43N5O2 |
Purity | ≥95% |
Target | Bromodomain |
Solubility | DMSO: 5 mg/mL, clear |
Storage | Store at -20°C |
IC50 | 120 nM (Kd) |
IUPAC Name | [3-anilino-4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
InChI | InChI=1S/C32H43N5O2/c38-31(36-20-12-27(13-21-36)34-16-4-5-17-34)25-10-11-29(30(24-25)33-26-8-2-1-3-9-26)32(39)37-22-14-28(15-23-37)35-18-6-7-19-35/h1-3,8-11,24,27-28,33H,4-7,12-23H2 |
InChIKey | PQOOIERVZAXHBP-UHFFFAOYSA-N |
SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC(=C(C=C3)C(=O)N4CCC(CC4)N5CCCC5)NC6=CC=CC=C6 |
Reference | <p style=/line-height:25px/> |