UNC1215 (Cat.No:I001593) is a potent inhibitor of the histone methyltransferase, EZH2. It selectively targets the catalytic SET domain of EZH2, leading to the inhibition of histone H3 lysine 27 methylation. UNC1215 has shown promise as a valuable tool in epigenetic research and may have implications in cancer therapeutics targeting EZH2-driven pathways.
| Catalog Number | I001593 |
| CAS Number | 1415800-43-9 |
| Synonyms | [3-anilino-4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| Molecular Formula | C32H43N5O2 |
| Purity | 95% |
| Target | Bromodomain |
| Solubility | DMSO: 5 mg/mL, clear |
| Storage | Store at -20°C |
| IC50 | 120 nM (Kd) [1] |
| IUPAC Name | [3-anilino-4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| InChI | InChI=1S/C32H43N5O2/c38-31(36-20-12-27(13-21-36)34-16-4-5-17-34)25-10-11-29(30(24-25)33-26-8-2-1-3-9-26)32(39)37-22-14-28(15-23-37)35-18-6-7-19-35/h1-3,8-11,24,27-28,33H,4-7,12-23H2 |
| InChIKey | PQOOIERVZAXHBP-UHFFFAOYSA-N |
| SMILES | O=C(N1CCC(N2CCCC2)CC1)C3=CC=C(C(N4CCC(N5CCCC5)CC4)=O)C=C3NC6=CC=CC=C6 |
| Reference | <p style=/line-height:25px/> |
