For research use only. Not for therapeutic Use.
Umifenovir（Cat No.:M109027）, also known as Arbidol, is an antiviral drug primarily used to treat respiratory infections caused by influenza and other viruses, including some coronaviruses. It works by inhibiting viral fusion with host cells, thereby preventing viral entry and replication. Umifenovir has shown broad-spectrum antiviral activity, making it a potential candidate for treating various viral infections. It is often used in combination with other antiviral agents to enhance therapeutic effects. Clinical studies suggest it may also offer benefits in treating other respiratory illnesses and potentially modulating immune responses in viral infections.
| CAS Number | 131707-25-0 |
| Synonyms | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| Molecular Formula | C22H25BrN2O3S |
| Purity | ≥95% |
| IUPAC Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| InChI | InChI=1S/C22H25BrN2O3S/c1-5-28-22(27)20-18(13-29-14-9-7-6-8-10-14)25(4)17-11-16(23)21(26)15(19(17)20)12-24(2)3/h6-11,26H,5,12-13H2,1-4H3 |
| InChIKey | KCFYEAOKVJSACF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C(=C21)CN(C)C)O)Br)C)CSC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
