For research use only. Not for therapeutic Use.
ULK1-IN-2（Cat No.:I043913）is a selective small molecule inhibitor that targets ULK1 (Unc-51 Like Autophagy Activating Kinase 1), a key regulator of autophagy, a process essential for cellular homeostasis and response to stress. ULK1 is involved in the initiation of autophagosome formation and plays a significant role in regulating cellular metabolism, survival, and immune responses. By inhibiting ULK1, ULK1-IN-2 disrupts autophagy, making it a promising candidate for treating diseases associated with dysregulated autophagy, such as cancer, neurodegenerative diseases, and infections. Preclinical studies suggest its potential in modulating autophagic processes for therapeutic benefit.
| CAS Number | 2497409-01-3 |
| Synonyms | 5-bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| Molecular Formula | C19H16BrFN4O6 |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| InChI | InChI=1S/C19H16BrFN4O6/c1-28-15-6-10(7-16(29-2)17(15)30-3)23-19-22-9-12(20)18(24-19)31-14-5-4-11(25(26)27)8-13(14)21/h4-9H,1-3H3,(H,22,23,24) |
| InChIKey | CVOMZGNACQPPDA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)NC2=NC=C(C(=N2)OC3=C(C=C(C=C3)[N+](=O)[O-])F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
