For research use only. Not for therapeutic Use.
UK 432097 (CAT: I009224) is a potent adenosine A2A receptor agonist with potential applications in the treatment of chronic obstructive pulmonary disease (COPD). By selectively targeting the adenosine A2A receptor, UK 432097 exhibits pharmacologic action by promoting bronchodilation and exerting anti-inflammatory effects in the lungs. This compound specifically acts on the adenosine A2A receptor, a G-protein coupled receptor involved in regulating inflammation and immune responses. The therapeutic potential of UK 432097 lies in its ability to improve lung function and reduce inflammation, making it a promising candidate for the management of COPD and potentially other respiratory conditions.
| CAS Number | 380221-63-6 |
| Synonyms | UK-432097; UK432097; UK 432097;6-((2,2-diphenylethyl)amino)-9-((2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxytetrahydrofuran-2-yl)-N-(2-(3-(1-(pyridin-2-yl)piperidin-4-yl)ureido)ethyl)-9H-purine-2-carboxamide |
| Molecular Formula | C40H47N11O6 |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-[(1-pyridin-2-ylpiperidin-4-yl)carbamoylamino]ethyl]purine-2-carboxamide |
| InChI | InChI=1S/C40H47N11O6/c1-2-41-37(54)33-31(52)32(53)39(57-33)51-24-46-30-34(45-23-28(25-11-5-3-6-12-25)26-13-7-4-8-14-26)48-35(49-36(30)51)38(55)43-19-20-44-40(56)47-27-16-21-50(22-17-27)29-15-9-10-18-42-29/h3-15,18,24,27-28,31-33,39,52-53H,2,16-17,19-23H2,1H3,(H,41,54)(H,43,55)(H2,44,47,56)(H,45,48,49)/t31-,32+,33-,39+/m0/s1 |
| InChIKey | ZOTHAEBAWXWVID-HXEFRTELSA-N |
| SMILES | CCNC(=O)C1C(C(C(O1)N2C=NC3=C2N=C(N=C3NCC(C4=CC=CC=C4)C5=CC=CC=C5)C(=O)NCCNC(=O)NC6CCN(CC6)C7=CC=CC=N7)O)O |
| Reference | <br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |