UF010(CAT: I003966) exhibits strong inhibitory activity against HDACs 3, 2, 1, and 8 with IC50 values ranging from 0.06 μM to 1.5 μM. It demonstrates selectivity for these HDAC isoforms over other HDACs. UF010 acts as a competitive inhibitor with a fast-on/slow-off binding mechanism to HDACs. In vitro studies have shown that UF010 promotes the accumulation of acetylated histones, leading to cell cycle arrest at the G1/S transition and inhibiting the proliferation of various cancer cell lines. It also activates tumor suppression mechanisms while inhibiting oncogenic pathways.
Catalog Number | I003966 |
CAS Number | 537672-41-6 |
Synonyms | 4-bromo-benzoic acid, 2-butylhydrazide |
Molecular Formula | C₁₁H₁₅BrN₂O |
Purity | 95% |
Target | HDAC |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 0.06 μM (HDAC3), 0.1 μM (HDAC2), 0.5 μM (HDAC1), 1.5 μM(HDAC 8) |
InChI | 1S/C11H15BrN2O/c1-2-3-8-13-14-11(15)9-4-6-10(12)7-5-9/h4-7,13H,2-3,8H2,1H3,(H,14,15) |
InChIKey | BVQCFCYPFJOOAV-UHFFFAOYSA-N |
SMILES | CCCCNNC(=O)C1=CC=C(C=C1)Br |
Reference | <p style=/line-height:25px/> </p> |