For research use only. Not for therapeutic Use.
UCB-5307（Cat No.:I043533）is a small-molecule inhibitor targeting the Bruton’s tyrosine kinase (BTK), a critical enzyme involved in the activation and function of B cells in the immune system. By inhibiting BTK, UCB-5307 modulates immune responses and is being investigated as a potential treatment for autoimmune diseases, such as rheumatoid arthritis and lupus, as well as certain B-cell malignancies like non-Hodgkin lymphoma. Its selective inhibition of BTK offers a targeted approach to disrupt the overactive immune signaling without broadly suppressing immune function, which could reduce unwanted side effects. Clinical trials are underway to evaluate its safety and efficacy.
| CAS Number | 1515887-44-1 |
| Synonyms | [1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]-pyridin-4-ylmethanol |
| Molecular Formula | C22H21N3O |
| Purity | ≥95% |
| IUPAC Name | [1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]-pyridin-4-ylmethanol |
| InChI | InChI=1S/C22H21N3O/c1-15-7-8-16(2)18(13-15)14-25-20-6-4-3-5-19(20)24-22(25)21(26)17-9-11-23-12-10-17/h3-13,21,26H,14H2,1-2H3 |
| InChIKey | MKABLXAUPLCAHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CN2C3=CC=CC=C3N=C2C(C4=CC=NC=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
