For research use only. Not for therapeutic Use.
UBE2T/FANCL-IN-1（Cat No.:I044340）is a selective small-molecule inhibitor targeting the UBE2T–FANCL complex, a crucial component of the Fanconi anemia (FA) DNA repair pathway. UBE2T is an E2 ubiquitin-conjugating enzyme, and FANCL is its partner E3 ligase; together, they monoubiquitinate FANCD2/FANCI, initiating DNA interstrand crosslink repair. By disrupting this interaction, UBE2T/FANCL-IN-1 impairs DNA repair, leading to the accumulation of genomic instability in cancer cells. This inhibitor is a valuable tool for studying the FA pathway and holds therapeutic potential in sensitizing tumors to DNA-damaging agents, particularly in FA-deficient or repair-compromised cancers.
| CAS Number | 1359415-02-3 |
| Synonyms | 7-(4-ethylpiperazin-1-yl)-5-methyl-2-[(2-methylpiperidin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Formula | C19H31N7 |
| Purity | ≥95% |
| IUPAC Name | 7-(4-ethylpiperazin-1-yl)-5-methyl-2-[(2-methylpiperidin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChI | InChI=1S/C19H31N7/c1-4-23-9-11-24(12-10-23)18-13-15(2)20-19-21-17(22-26(18)19)14-25-8-6-5-7-16(25)3/h13,16H,4-12,14H2,1-3H3 |
| InChIKey | FJHJBABGFHVIDS-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=CC(=NC3=NC(=NN23)CN4CCCCC4C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
