For research use only. Not for therapeutic Use.
Tyrosol (Cat No.: R048689) is a natural phenolic compound with the molecular formula C8H10O2, commonly found in olive oil, wine, and other plant-based foods. Structurally, it consists of a hydroxyethyl group attached to a benzene ring, making it a simple phenylethanoid. Tyrosol exhibits antioxidant, anti-inflammatory, and cardioprotective properties and contributes to the health benefits of the Mediterranean diet. It helps protect cells from oxidative stress and has been studied for its role in neuroprotection, cardiovascular health, and potential therapeutic applications in chronic diseases.
| CAS Number | 501-94-0 |
| Synonyms | 4-Hydroxy-benzeneethanol; 2-(4-Hydroxyphenyl)ethanol; 2-(4-Hydroxyphenyl)ethyl Alcohol; NSC 59876; Metoprolol Impurity G |
| Molecular Formula | C8H10O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Store at +4C |
| IUPAC Name | 4-(2-hydroxyethyl)phenol |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
| InChIKey | YCCILVSKPBXVIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
