For research use only. Not for therapeutic Use.
Tyrosinase-IN-2(Cat No.:I043716)is a selective small molecule inhibitor designed to target tyrosinase, an enzyme crucial in the biosynthesis of melanin. Tyrosinase catalyzes the conversion of tyrosine to melanin, making it a key player in pigmentation and skin color. By inhibiting tyrosinase, Tyrosinase-IN-2 can potentially reduce melanin production, making it useful in treating hyperpigmentation disorders like age spots, melasma, and freckles. Additionally, it may have applications in cosmetic formulations for skin lightening. Preclinical studies suggest Tyrosinase-IN-2’s potential in modulating pigmentation and addressing various skin-related conditions.
| CAS Number | 180864-33-9 |
| Synonyms | [(E)-(4-nitrophenyl)methylideneamino]thiourea |
| Molecular Formula | C8H8N4O2S |
| Purity | ≥95% |
| IUPAC Name | [(E)-(4-nitrophenyl)methylideneamino]thiourea |
| InChI | InChI=1S/C8H8N4O2S/c9-8(15)11-10-5-6-1-3-7(4-2-6)12(13)14/h1-5H,(H3,9,11,15)/b10-5+ |
| InChIKey | HSDCBIHJEGDMDO-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1/C=N/NC(=S)N)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |