For research use only. Not for therapeutic Use.
Tyr-Gly-Gly-Phe-Met-OH(Cat No.:I004188) is a peptide sequence that has been found to regulate human immune function and exhibit anti-tumor effects. It acts by binding to opioid receptors, specifically the delta-opioid receptor subtype. Activation of these receptors can modulate immune responses and exert anti-inflammatory effects. Additionally, binding to opioid receptors may contribute to the inhibition of tumor growth. Further research is necessary to fully understand the mechanisms and potential therapeutic applications of Tyr-Gly-Gly-Phe-Met-OH in immune regulation and cancer treatment.
| CAS Number | 58569-55-4 |
| Molecular Formula | C27H35N5O7S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO: ≥ 40 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
| InChI | InChI=1S/C27H35N5O7S/c1-40-12-11-21(27(38)39)32-26(37)22(14-17-5-3-2-4-6-17)31-24(35)16-29-23(34)15-30-25(36)20(28)13-18-7-9-19(33)10-8-18/h2-10,20-22,33H,11-16,28H2,1H3,(H,29,34)(H,30,36)(H,31,35)(H,32,37)(H,38,39)/t20-,21-,22-/m0/s1 |
| InChIKey | YFGBQHOOROIVKG-FKBYEOEOSA-N |
| SMILES | CSCCC(C(=O)O)NC(=O)C(CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(=O)C(CC2=CC=C(C=C2)O)N |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |