For research use only. Not for therapeutic Use.
Tuxobertinib（Cat No.:I023129）is a next-generation, orally bioavailable small-molecule inhibitor targeting mutant forms of the epidermal growth factor receptor (EGFR), including EGFR exon 20 insertion mutations, which are often resistant to first- and second-generation EGFR inhibitors. Developed to overcome these resistance mechanisms, Tuxobertinib selectively binds and inhibits aberrant EGFR signaling pathways involved in tumor growth and survival, particularly in non-small cell lung cancer (NSCLC). Its enhanced potency and selectivity offer improved therapeutic potential with reduced off-target toxicity. Tuxobertinib is currently under investigation in clinical trials for advanced EGFR-mutant cancers.
| CAS Number | 2414572-47-5 |
| Synonyms | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-(2-morpholin-4-ylethoxy)quinazolin-6-yl]prop-2-enamide |
| Molecular Formula | C29H29ClN6O4 |
| Purity | ≥95% |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-(2-morpholin-4-ylethoxy)quinazolin-6-yl]prop-2-enamide |
| InChI | InChI=1S/C29H29ClN6O4/c1-2-28(37)35-25-16-22-24(17-27(25)39-14-11-36-9-12-38-13-10-36)32-19-33-29(22)34-20-6-7-26(23(30)15-20)40-18-21-5-3-4-8-31-21/h2-8,15-17,19H,1,9-14,18H2,(H,35,37)(H,32,33,34) |
| InChIKey | HIBPKFXWOPYJPZ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)OCC4=CC=CC=N4)Cl)OCCN5CCOCC5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
