For research use only. Not for therapeutic Use.
TrxR-IN-5（Cat No.:I043506）is a selective inhibitor of thioredoxin reductase (TrxR), an enzyme that plays a key role in cellular redox regulation and maintaining antioxidant defense. By inhibiting TrxR, TrxR-IN-5 disrupts the balance of cellular oxidation and reduction, leading to increased oxidative stress. This can induce apoptosis in rapidly dividing cells, making it a promising therapeutic candidate for cancer treatment. Additionally, TrxR-IN-5 may have potential applications in treating diseases where oxidative stress is a contributing factor. Preclinical studies are ongoing to evaluate its efficacy and safety in various cancer models and other disorders.
| Synonyms | (6E)-6-[[4-[4-[(Z)-(2-oxocyclohex-3-en-1-ylidene)methyl]phenoxy]phenyl]methylidene]cyclohex-2-en-1-one |
| Molecular Formula | C26H22O3 |
| Purity | ≥95% |
| IUPAC Name | (6E)-6-[[4-[4-[(Z)-(2-oxocyclohex-3-en-1-ylidene)methyl]phenoxy]phenyl]methylidene]cyclohex-2-en-1-one |
| InChI | InChI=1S/C26H22O3/c27-25-7-3-1-5-21(25)17-19-9-13-23(14-10-19)29-24-15-11-20(12-16-24)18-22-6-2-4-8-26(22)28/h3-4,7-18H,1-2,5-6H2/b21-17-,22-18+ |
| InChIKey | BIAIWJANZKBISX-QGFZOGOGSA-N |
| SMILES | C1C/C(=C\C2=CC=C(C=C2)OC3=CC=C(C=C3)/C=C\4/CCC=CC4=O)/C(=O)C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
