For research use only. Not for therapeutic Use.
TRPV1 antagonist 3（Cat No.:I043891）is a small molecule compound that selectively inhibits the transient receptor potential vanilloid 1 (TRPV1) ion channel, which plays a key role in detecting and regulating pain, heat, and inflammation. By blocking TRPV1 activity, TRPV1 antagonist 3 may reduce pain perception, making it a promising candidate for treating chronic pain conditions, such as neuropathic pain and inflammatory pain. This compound has been studied for its potential analgesic properties and its ability to modulate pain pathways, offering a novel approach in pain management without the side effects of traditional analgesics.
| CAS Number | 2765294-54-8 |
| Synonyms | (2S)-2-(5-phenyl-1,3-thiazol-2-yl)-N-(3-propan-2-ylphenyl)pyrrolidine-1-carboxamide |
| Molecular Formula | C23H25N3OS |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(5-phenyl-1,3-thiazol-2-yl)-N-(3-propan-2-ylphenyl)pyrrolidine-1-carboxamide |
| InChI | InChI=1S/C23H25N3OS/c1-16(2)18-10-6-11-19(14-18)25-23(27)26-13-7-12-20(26)22-24-15-21(28-22)17-8-4-3-5-9-17/h3-6,8-11,14-16,20H,7,12-13H2,1-2H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | CZISSZWUQQBGMU-FQEVSTJZSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)NC(=O)N2CCCC2C3=NC=C(S3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
