For research use only. Not for therapeutic Use.
TRPM8 antagonist 3（Cat No.:I045172）is a potent and selective inhibitor of the transient receptor potential melastatin 8 (TRPM8) channel, a cold-sensing ion channel activated by cool temperatures and menthol. By blocking TRPM8 activity, it reduces cold sensation signaling and alleviates cold hypersensitivity and pain associated with neuropathic and inflammatory conditions. This antagonist is a valuable research tool for studying thermosensory pathways, peripheral nerve function, and TRPM8-mediated mechanisms in sensory disorders. TRPM8 antagonist 3 holds potential for developing novel analgesics targeting cold-induced pain and discomfort without affecting normal heat or mechanical sensation.
| CAS Number | 2102179-29-1 |
| Synonyms | [4-hydroxy-2-(2-hydroxyphenyl)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| Molecular Formula | C13H12N2O4S |
| Purity | ≥95% |
| IUPAC Name | [4-hydroxy-2-(2-hydroxyphenyl)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| InChI | InChI=1S/C13H12N2O4S/c16-9-5-2-1-4-8(9)12-14-11(17)10(20-12)13(18)15-6-3-7-19-15/h1-2,4-5,16-17H,3,6-7H2 |
| InChIKey | BKUQCBLRBYEPFS-UHFFFAOYSA-N |
| SMILES | C1CN(OC1)C(=O)C2=C(N=C(S2)C3=CC=CC=C3O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
