For research use only. Not for therapeutic Use.
Trp-Ala(Cat No.:L007012), also known as tryptophylalanine, is a dipeptide consisting of the amino acids tryptophan (Trp) and alanine (Ala). This dipeptide is involved in various biological processes and is often studied in the context of protein chemistry and enzymatic reactions. Tryptophan, an essential amino acid, contributes to protein synthesis and is a precursor for neurotransmitters and other bioactive molecules. Alanine, a non-essential amino acid, plays a role in glucose metabolism and energy production.
| CAS Number | 24046-71-7 |
| Molecular Formula | C14H17N3O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid |
| InChI | InChI=1S/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,11-/m0/s1 |
| InChIKey | OHGNSVACHBZKSS-KWQFWETISA-N |
| SMILES | CC(C(=O)O)NC(=O)C(CC1=CNC2=CC=CC=C21)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |