For research use only. Not for therapeutic Use.
Trotabresib (Cat No.:I024233) is an orally bioavailable, selective inhibitor of BET (bromodomain and extraterminal domain) proteins, particularly BRD2, BRD3, and BRD4. These proteins regulate gene transcription by recognizing acetylated lysine residues on histones. By blocking BET function, trotabresib downregulates oncogenic drivers such as MYC, leading to antiproliferative and pro-apoptotic effects in cancer cells. It is currently under clinical investigation for various solid tumors and hematologic malignancies. Trotabresib is a promising epigenetic therapeutic candidate, aimed at modulating transcriptional programs involved in cancer progression and resistance.
| CAS Number | 1706738-98-8 |
| Synonyms | 4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one |
| Molecular Formula | C21H21NO4S |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one |
| InChI | InChI=1S/C21H21NO4S/c1-22-12-19(16-5-3-4-6-17(16)21(22)23)18-11-15(27(2,24)25)9-10-20(18)26-13-14-7-8-14/h3-6,9-12,14H,7-8,13H2,1-2H3 |
| InChIKey | UWZAJPITKGWMFJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C2C1=O)C3=C(C=CC(=C3)S(=O)(=O)C)OCC4CC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
