Tropolone is a naturally occurring seven-membered aromatic ring compound with a hydroxyl group (OH) attached to the ring. It is known for its unique structure, which includes an unsaturated carbon ring with alternating double bonds, making it distinct from typical aromatic compounds. Tropolone exhibits a variety of biological activities, including antimicrobial, antifungal, and anticancer properties. It has been studied for its ability to inhibit enzymes such as polyphenol oxidase and lactase, making it a useful compound in biochemical research. Additionally, its metal-chelating properties are of interest in the development of new drugs and therapeutic agents.
Catalog Number | R006193 |
CAS Number | 533-75-5 |
Molecular Formula | C7H6O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-hydroxycyclohepta-2,4,6-trien-1-one |
InChI | InChI=1S/C7H6O2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H,8,9) |
InChIKey | MDYOLVRUBBJPFM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=O)C=C1)O |