For research use only. Not for therapeutic Use.
Trometamoyloxy Fosfomycin-dimer is a high-purity compound used in advanced pharmaceutical research. This dimerized form of Fosfomycin, modified with trometamoyloxy groups, is crucial for studying antibiotic resistance and bacterial infections. Its stable structure ensures precise and reliable results, making it indispensable for drug development and microbiological studies. Ideal for experimental setups, it enhances research accuracy.
CAS Number | 1262243-12-8 |
Synonyms | Fosfomycin Trometamol Impurity D |
Molecular Formula | C10H25NO11P2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [2-[[2-[2-amino-3-hydroxy-2-(hydroxymethyl)propoxy]-1-hydroxypropyl]-hydroxyphosphoryl]oxy-1-hydroxypropyl]phosphonic acid |
InChI | InChI=1S/C10H25NO11P2/c1-6(21-5-10(11,3-12)4-13)9(15)24(19,20)22-7(2)8(14)23(16,17)18/h6-9,12-15H,3-5,11H2,1-2H3,(H,19,20)(H2,16,17,18) |
InChIKey | RDPFAWYPVPIZPV-UHFFFAOYSA-N |
SMILES | CC(C(O)P(=O)(O)OC(C)C(O)P(=O)(O)O)OCC(CO)(CO)N |