For research use only. Not for therapeutic Use.
ris[2-(3-mercaptopropionyloxy)ethyl] isocyanurate(CAT: M012312) is a chemical compound primarily used in the field of polymer chemistry. This compound serves as a multifunctional crosslinking agent and chain extender in the synthesis of various polymers, particularly in the development of polyurethane-based materials. Its structure includes three isocyanurate rings, each functionalized with mercaptopropionate groups, making it highly reactive with isocyanate compounds.
| CAS Number | 36196-44-8 |
| Synonyms | TRIS[2-(3-MERCAPTOPROPIONYLOXY)ETHYL] ISOCYANURATE;propanoicacid,3-mercapto-,(2,4,6-trioxo-1,3,5-triazine-1,3,5(2h,4h,6h)-triyl;propanoicacid,3-mercapto-,(2,4,6-trioxo-1,3,5-triazine-1,3,5(2h,4h,6h)-triyl)tri-2,1-ethanediylester;Propanoicacid,3-mercp |
| Molecular Formula | C18H27N3O9S3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-(3-sulfanylpropanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-sulfanylpropanoate |
| InChI | InChI=1S/C18H27N3O9S3/c22-13(1-10-31)28-7-4-19-16(25)20(5-8-29-14(23)2-11-32)18(27)21(17(19)26)6-9-30-15(24)3-12-33/h31-33H,1-12H2 |
| InChIKey | CFKONAWMNQERAG-UHFFFAOYSA-N |
| SMILES | C(CS)C(=O)OCCN1C(=O)N(C(=O)N(C1=O)CCOC(=O)CCS)CCOC(=O)CCS |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |