For research use only. Not for therapeutic Use.
Tris(4-formylphenyl)amine (Cat No.: M018659) is an organic compound featuring a triphenylamine core with three para-formyl (–CHO) substituents. This tri-functional aldehyde is commonly used as a building block in the synthesis of covalent organic frameworks (COFs), porous polymers, and advanced materials for optoelectronic applications. Its electron-donating amine center and conjugated aromatic structure enable efficient charge transport and tunable electronic properties. It serves in the development of sensors, light-emitting devices, and photovoltaic materials, offering versatility in designing functional, π-conjugated molecular architectures.
| CAS Number | 119001-43-3 |
| Molecular Formula | C21H15NO3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 4-(4-formyl-N-(4-formylphenyl)anilino)benzaldehyde |
| InChI | InChI=1S/C21H15NO3/c23-13-16-1-7-19(8-2-16)22(20-9-3-17(14-24)4-10-20)21-11-5-18(15-25)6-12-21/h1-15H |
| InChIKey | YOXHQRNDWBRUOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N(C2=CC=C(C=C2)C=O)C3=CC=C(C=C3)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
