For research use only. Not for therapeutic Use.
Tris(2-ethylhexyl)amine(Cat No.:R035737) is a chemical compound used primarily as an extractant in the purification of metals from aqueous solutions. Its structure features three 2-ethylhexyl groups attached to a central nitrogen atom, making it highly effective in coordinating and solubilizing metal ions, especially in the mining and metallurgical industries. It facilitates the selective separation of metals by forming complexes with them, which can then be extracted from the mixture. Additionally, this amine finds applications in the production of plastics and other polymers, where it acts as a catalyst or a stabilizer.
| CAS Number | 1860-26-0 |
| Synonyms | 2-Ethyl-N,N-bis(2-ethylhexyl)-1-hexanamine; 2,2’,2’’-triethyl-(6CI,7CI,8CI)?Trihexylamine; 2-Ethyl-N,N-bis(2-ethylhexyl)-1-hexanamine; TEHA; Tri(2-ethylhexyl)amine;?? |
| Molecular Formula | C24H51N |
| Purity | ≥95% |
| Documentation | |
| Storage | Store at -20C |
| IUPAC Name | 2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine |
| InChI | InChI=1S/C24H51N/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 |
| InChIKey | BZUDVELGTZDOIG-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)CC(CC)CCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |