For research use only. Not for therapeutic Use.
Triphenylphosphine is a high-purity organophosphorus compound essential for advanced pharmaceutical and chemical research. This phosphine is crucial for studies involving catalytic reactions, organic synthesis, and ligand chemistry. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| CAS Number | 603-35-0 |
| Synonyms | EPCAT-P; JC 263; NSC 10; NSC 215203; P 100; P 100 (accelerator); PP 200; PP 360; PPH 3; TPP; Triphenylphosphane; Triphenylphosphide; Triphenylphosphine; Triphenylphosphorus; PPh3 |
| Molecular Formula | C18H15P |
| Purity | ≥95% |
| Storage | 2°C to 8°C |
| IUPAC Name | triphenylphosphane |
| InChI | InChI=1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |