For research use only. Not for therapeutic Use.
| CAS Number | 217-59-4 |
| Synonyms | 1,2,3,4-Dibenznaphthalene; 9,10-Benzophenanthrene; 9,10-Benzphenanthrene; Benzo[l]phenanthrene; Isochrysene; NSC 57455 |
| Molecular Formula | C18H12 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | triphenylene |
| InChI | InChI=1S/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H |
| InChIKey | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=CC=CC=C24 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |