Home
>
Reference Standards>Catalysts and Ligands> Triphenylene-2,3,6,7,10,11-hexaamine hexahydrochloride
For research use only. Not for therapeutic Use.
Triphenylene-2,3,6,7,10,11-hexaamine hexahydrochloride(Cat No.:R060114)is a polycyclic aromatic compound featuring six amine groups positioned symmetrically on a triphenylene core, stabilized as its hexahydrochloride salt. This highly functionalized molecule exhibits strong electron-donating properties and is widely used in supramolecular chemistry, coordination complexes, and materials science. Its planar, rigid aromatic structure promotes π–π stacking interactions, making it suitable for constructing organic semiconductors, conductive polymers, and molecular assemblies. The multiple amine groups facilitate binding to metal ions or other functional components, enabling applications in catalysis, sensing, and the development of novel electronic or photonic materials.
CAS Number | 1350518-27-2 |
Molecular Formula | C18H24Cl6N6 |
Purity | ≥95% |
IUPAC Name | triphenylene-2,3,6,7,10,11-hexamine;hexahydrochloride |
InChI | InChI=1S/C18H18N6.6ClH/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11;;;;;;/h1-6H,19-24H2;6*1H |
InChIKey | PUXBEKLSMBVFNW-UHFFFAOYSA-N |
SMILES | C1=C2C3=CC(=C(C=C3C4=CC(=C(C=C4C2=CC(=C1N)N)N)N)N)N.Cl.Cl.Cl.Cl.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |