For research use only. Not for therapeutic Use.
Triphenyl phosphate (TPP) is an organophosphate compound composed of three phenyl groups attached to a phosphate backbone. It is widely used as a flame retardant, plasticizer, and additive in various products, including plastics, resins, and textiles. TPP functions by forming a protective layer that inhibits the spread of flames. Despite its effectiveness, there are concerns about its environmental persistence and potential health impacts. Ongoing research aims to develop safer alternatives to triphenyl phosphate for fire safety applications.
| CAS Number | 115-86-6 |
| Synonyms | Phosphoric Acid Triphenyl Ester; Celluflex TPP; Disflamoll TP; NSC 57868; Phenyl Phosphate; Phoscon FR 903N; Phosflex TPP; Reofos TPP; S 4; Sumilizer TPP; TP; TPP; TPPA; TTP; Triphenoxyphosphine Oxide; Wako TPP; TPPHP |
| Molecular Formula | (C6H5)3PO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | triphenyl phosphate |
| InChI | InChI=1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| InChIKey | XZZNDPSIHUTMOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |