For research use only. Not for therapeutic Use.
Trioctylmethylammonium Chloride（Cat No.:R020960）is a quaternary ammonium salt characterized by three long-chain octyl groups and one methyl group surrounding a central nitrogen atom. It is widely used as a phase-transfer catalyst, facilitating reactions between immiscible phases, especially in nucleophilic substitution, oxidation, and alkylation reactions. Its lipophilic nature enhances solubility in organic media, making it ideal for industrial processes, including polymerization and surfactant synthesis. Additionally, it serves in ion-exchange systems and extraction applications. This compound offers high thermal and chemical stability, supporting efficient transformations in both laboratory and production environments.
| CAS Number | 5137-55-3 |
| Synonyms | Tricaprylylmethylammonium Chloride; Aliquat 336; |
| Molecular Formula | C25H54N.Cl |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl(trioctyl)azanium;chloride |
| InChI | InChI=1S/C25H54N.ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;/h5-25H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XKBGEWXEAPTVCK-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
