For research use only. Not for therapeutic Use.
Trimethyl isocyanurate(Cat No.:L007873), with the chemical formula C6H9N3O3. It is a chemical compound composed of three methyl groups attached to an isocyanurate ring. This compound is widely used as a crosslinking agent in the production of various coatings, adhesives, and foams. It enhances the properties of these materials, providing improved stability, durability, and heat resistance. Trimethyl isocyanurate’s unique structure makes it valuable in the manufacturing industry, particularly in applications requiring high-performance materials. Its use contributes to the development of advanced coatings and adhesives for diverse industrial and commercial purposes.
CAS Number | 827-16-7 |
Molecular Formula | C6H9N3O3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione |
InChI | InChI=1S/C6H9N3O3/c1-7-4(10)8(2)6(12)9(3)5(7)11/h1-3H3 |
InChIKey | AHWDQDMGFXRVFB-UHFFFAOYSA-N |
SMILES | CN1C(=O)N(C(=O)N(C1=O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |