For research use only. Not for therapeutic Use.
Triiodomesitylene (Cat.No:L003971) is a significant chemical compound known for its unique structure and reactivity. Comprising three iodine atoms attached to a mesitylene framework, it exhibits distinct properties valuable in various chemical reactions. This compound finds applications in organic synthesis, particularly in the creation of specialized molecules for research and industrial purposes.
| CAS Number | 19025-36-6 |
| Molecular Formula | C9H9I3 |
| Purity | ≥95% |
| IUPAC Name | 1,3,5-triiodo-2,4,6-trimethylbenzene |
| InChI | InChI=1S/C9H9I3/c1-4-7(10)5(2)9(12)6(3)8(4)11/h1-3H3 |
| InChIKey | UUMJKZVRNPVQAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1I)C)I)C)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |