Triethoxyphosphine is a high-purity organophosphorus compound essential for advanced pharmaceutical and chemical research. This reagent is crucial for studies involving phosphine ligands, catalytic processes, and organic synthesis. With its high reactivity and stability, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
Catalog Number | R021867 |
CAS Number | 122-52-1 |
Synonyms | Triethyl Phosphite; Tris(ethoxy)phosphine; Ethyl Phosphite, (EtO)3P (7CI); Ethyl Phosphite, Et3PO3 (4CI); NSC 5284; Phosphorous Acid Triethyl Ester; |
Molecular Formula | C6H15O3P |
Purity | 95% |
Storage | Store at +4C |
IUPAC Name | triethyl phosphite |
InChI | InChI=1S/C6H15O3P/c1-4-7-10(8-5-2)9-6-3/h4-6H2,1-3H3 |
InChIKey | BDZBKCUKTQZUTL-UHFFFAOYSA-N |
SMILES | CCOP(OCC)OCC |