For research use only. Not for therapeutic Use.
TRIDODECYLAMINE (Cat.No:M070040) is a long-chain amine compound commonly used as a surfactant and emulsifier in various industrial and consumer products. Its hydrophobic properties make it suitable for applications such as fabric softeners, antistatic agents, and corrosion inhibitors. TRIDODECYLAMINE plays a crucial role in enhancing product performance and stability.
| CAS Number | 102-87-4 |
| Molecular Formula | C36H75N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N,N-didodecyldodecan-1-amine |
| InChI | InChI=1S/C36H75N/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-36H2,1-3H3 |
| InChIKey | SWZDQOUHBYYPJD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCN(CCCCCCCCCCCC)CCCCCCCCCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |