For research use only. Not for therapeutic Use.
Tricarballylic Acid(Cat No.:M289768)is a naturally occurring tricarboxylic acid found in certain plants and fungi. Structurally similar to citric acid but lacking the hydroxyl group, it can act as an inhibitor in the citric acid cycle when metabolized by specific enzymes. Tricarballylic acid is studied for its potential toxic effects, as its accumulation in animal feed can impair energy metabolism, leading to growth and health issues. Its relevance in research includes metabolic pathway studies and understanding the impact of natural compounds on animal nutrition and toxicity in feed formulations.
CAS Number | 99-14-9 |
Molecular Formula | C6H8O6 |
Purity | ≥95% |
Target | Mitochondrial Metabolism |
IUPAC Name | propane-1,2,3-tricarboxylic acid |
InChI | InChI=1S/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
InChIKey | KQTIIICEAUMSDG-UHFFFAOYSA-N |
SMILES | C(C(CC(=O)O)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |