For research use only. Not for therapeutic Use.
Triacetin(Cat No.:I000174)is a synthetic chemical compound that serves as the triester of glycerol and acetic acid. It is classified as an artificial or synthetic fat and is considered the second simplest fat, following triformin. Triacetin finds application in various industries, including food, pharmaceuticals, and cosmetics, where it is used as an additive, emulsifier, stabilizer, or solvent. Its versatile properties make it a valuable ingredient in the formulation of products such as confectionery, pharmaceutical tablets, and personal care items.
CAS Number | 102-76-1 |
Molecular Formula | C9H14O6 |
Purity | ≥95% |
Documentation | |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: ≥ 2.3 mg/mL |
Storage | Room Temperature |
IUPAC Name | 2,3-diacetyloxypropyl acetate |
InChI | InChI=1S/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
InChIKey | URAYPUMNDPQOKB-UHFFFAOYSA-N |
SMILES | CC(=O)OCC(COC(=O)C)OC(=O)C |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |