For research use only. Not for therapeutic Use.
Tri-O-acetyl-D-glucal (Cat No.:R011982) is a partially protected derivative of D-glucal, featuring three acetyl groups on hydroxyl positions of the sugar ring. It is commonly used as an intermediate in carbohydrate chemistry for the synthesis of glycosides and oligosaccharides. The acetyl groups enhance solubility in organic solvents and prevent unwanted side reactions, while the unsaturated enol ether moiety at the anomeric position allows for further functionalization. Tri-O-acetyl-D-glucal is valuable in developing bioactive sugar derivatives, vaccine candidates, and glycomimetic drug molecules.
| CAS Number | 2873-29-2 |
| Synonyms | 1,5-Anhydro-2-deoxy-D-arabino-Hex-1-enitol 3,4,6-Triacetate; 3,4,6-Tri-O-acetyl-D-glucal; 3,4,6-Tri-O-acetylglucal; D-Glucal Triacetate; Triacetyl-D-glucal; |
| Molecular Formula | C12H16O7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChI | InChI=1S/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | LLPWGHLVUPBSLP-UTUOFQBUSA-N |
| SMILES | CC(=O)OCC1C(C(C=CO1)OC(=O)C)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |