For research use only. Not for therapeutic Use.
Tretazicar (CAT: R016430) is a nitroaromatic prodrug with strong potential in anticancer research. It requires enzymatic activation, most notably by bacterial nitroreductase, to form highly cytotoxic metabolites that induce DNA interstrand crosslinks and block tumor cell replication. Tretazicar has been studied in gene-directed enzyme prodrug therapy (GDEPT), where targeted expression of nitroreductase in cancer cells enhances selective tumor toxicity while sparing normal tissue. Its unique mechanism of bioactivation makes it a powerful tool for exploring targeted cancer therapies, drug delivery strategies, and tumor-specific cytotoxicity. Tretazicar continues to serve as an important reference compound in experimental oncology.
| CAS Number | 21919-05-1 |
| Synonyms | 5-(aziridin-1-yl)-2,4-dinitrobenzamide |
| Molecular Formula | C9H8N4O5 |
| Purity | ≥95% |
| IUPAC Name | 5-(aziridin-1-yl)-2,4-dinitrobenzamide |
| InChI | InChI=1S/C9H8N4O5/c10-9(14)5-3-7(11-1-2-11)8(13(17)18)4-6(5)12(15)16/h3-4H,1-2H2,(H2,10,14) |
| InChIKey | WOCXQMCIOTUMJV-UHFFFAOYSA-N |
| SMILES | C1CN1C2=C(C=C(C(=C2)C(=O)N)[N+](=O)[O-])[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
