For research use only. Not for therapeutic Use.
Trans-2,3-dibromo-2-butene-1,4-diol is a diol, meaning it contains two hydroxyl groups (-OH) on adjacent carbon atoms. The trans- configuration indicates that the two bromine atoms are on opposite sides of the double bond. This compound may be used in organic synthesis or biochemical research due to its unique structure and properties.
CAS Number | 3234-02-4 |
Molecular Formula | C4H6Br2O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | (E)-2,3-dibromobut-2-ene-1,4-diol |
InChI | InChI=1S/C4H6Br2O2/c5-3(1-7)4(6)2-8/h7-8H,1-2H2/b4-3+ |
InChIKey | MELXIJRBKWTTJH-ONEGZZNKSA-N |
SMILES | C(C(=C(CO)Br)Br)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |