Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
Trans-(1-Benzylpyrrolidine-3,4-diyl)dimethanol
Trans-(1-Benzylpyrrolidine-3,4-diyl)dimethanol(CAT: L000359) is a crucial compound in the field of organic and pharmaceutical chemistry. This compound serves as an essential intermediate in the synthesis of various bioactive molecules, particularly in drug discovery and development. Its pyrrolidine structure, along with the presence of two hydroxyl groups, offers versatile reactivity, allowing for the creation of diverse organic compounds with potential pharmacological applications.
Catalog Number | L000359 |
CAS Number | 1345831-65-3 |
Molecular Formula | C13H19NO2 |
Purity | 95% |
IUPAC Name | [(3R,4R)-1-benzyl-4-(hydroxymethyl)pyrrolidin-3-yl]methanol |
InChI | InChI=1S/C13H19NO2/c15-9-12-7-14(8-13(12)10-16)6-11-4-2-1-3-5-11/h1-5,12-13,15-16H,6-10H2/t12-,13-/m1/s1 |
InChIKey | HLFKLRXUZKUZOP-CHWSQXEVSA-N |